"एसीटोन": अवतरणों में अंतर

छो बॉट: वर्तनी एकरूपता।
पंक्ति 1:
{{Chembox new
| Name = Acetone<ref>''Merck Index'', 11th Edition, '''58'''.</ref>
| ImageFileL1 = Acetone-2D-skeletal.svg
| ImageSizeL1 = 100px
| ImageNameL1 = एसीटोन (Acetone)
| ImageFileR1 = Acetone-3D-balls.png
| ImageSizeR1 = 100px
| ImageNameR1 = Ball-and-stick model of acetone
| ImageFile2 = Acetone-3D-vdW.png
| ImageSize2 = 150px
| ImageName2 = Space-filling model of acetone
| IUPACName = प्रोपेनोन
| OtherNames = β-कीटोप्रोपेन<br />Dimethyl ketone, DMK
| Section1 = {{Chembox Identifiers
| SMILES = CC(=O)C
| CASNo = 67-64-1
| RTECS = AL31500000
| ChemSpiderID = 175
| InChI=1/C3H6O/c1-3(2)4/h1-2H3
}}
| Section2 = {{Chembox Properties
| Formula = CH<sub>3</sub>COCH<sub>3</sub>
| MolarMass = 58.08 g/mol
| Appearance = रंगहीन द्रव्य
| Density = 0.79 g/cm³, तरल
| Solubility = [[miscible]]
| MeltingPt = −94.9&nbsp;°C (178.2 K)
| BoilingPt = 56.53&nbsp;°C (329.4 K)
| Viscosity = 0.32 c[[पॉयज़|P]] at 20&nbsp;°C
}}
| Section3 = {{Chembox Structure
| MolShape = trigonal planar at C=O
| Dipole = 2.91 [[Debye|D]]
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass = [[ज्वलनशील]] ('''F''')<br />Irritant ('''Xi''')
| NFPA-H = 1
| NFPA-F = 3
| NFPA-R = 0
| RPhrases = {{R11}}, {{R36}}, {{R66}}, {{R67}}
| SPhrases = {{S2}}, {{S9}}, {{S16}}, {{S26}}
| FlashPt = -17&nbsp;°C
| Autoignition = 465&nbsp;°C
}}
| Section8 = {{Chembox Related
| Function = [[कीटोन]]
| OtherFunctn = [[ब्यूटेनोन]]
| Function = [[solvent]]s
| OtherFunctn = [[जल (अणु)|जल]]<br />[[इथेनॉल]]<br />[[आइसोप्रोपेनॉल]]<br />[[टॉलुईन]]
}}
}}
 
'''ऐसीटोन''' (Acetone) एक रंगहीन, अभिलाक्षणिक गंधवाला, ज्वलनशील द्रव है जो [[पानी]], [[ईथर]] और [[ऐलकोहल]] में मिश्रय है। यह [[काष्ठ]] के [[भंजक आसवन]] (destructive distillation) से प्राप्त [[पाइरोलिग्नियस अम्ल]] का घटक है। इसका मुख्य उपयोग [[विलायक]] के रूप में होता है। यह फिल्मों, शक्तिशाली विस्फोटकों, आसंजकों, काँच के समान एक प्लास्टिक ([[पर्स्पेक्स]]) और ओषधियों के निर्माण में काम आता है। अति शुद्ध ऐसीटोन का उपयोग इलेक्ट्रानिकी उद्योग में विभिन्न पुर्जो को सुखाने और उन्हें साफ करने के लिए होता है।
 
एसीटोन का सिस्टेमैटिक नाम 'प्रोपेनोन' (propanone) है। इसका अणुसूत्र (CH<sub>3</sub>)<sub>2</sub>CO है। <ref>Allen, P. W.; Bowen, H. J. M.; Sutton, L. E.; Bastiansen, O. (1952). "The molecular structure of acetone". Transactions of the Faraday Society 48: 991. doi:10.1039/TF9524800991.</ref> यह सबसे सरल [[कीटोन]] है।
 
== सन्दर्भ ==